1,2-Bis(2,4,6-tribromophenoxy)ethane
- SMILES
- C1=C(C=C(C(=C1Br)OCCOC2=C(C=C(C=C2Br)Br)Br)Br)Br
- CAS number
- 37853-59-1
- Formula
- C14 H8 Br6 O2
- Molecular weight
- Melting point
-
- Entropy of fusion
-
|
not specified
|
ΔfusS/J K-1 mol-1
|
|
Vapor pressure
| t/°C |
PS/Pa |
PL/Pa |
log (PL/Pa) |
method and notes |
reference |
| 25 |
3.17E-8 |
3.23E-6 |
-5.49 |
EPI Suite estimation |
|
|
3.88E-10 |
|
|
|
1 |
| 25 |
|
3.98E-6 |
-5.4 |
SPARC |
2 |
| 25 |
|
1.26E-10 |
-9.9 |
Absolv |
2 |
Water solubility
| t/°C |
SWS/mol m-3 |
SWL/mol m-3 |
log (SWL/mol m-3) |
method and notes |
reference |
| not specified |
Henry's law constant
| t/°C |
H/Pa m3 mol-1 |
KAW |
log (KAW) |
method and notes |
reference |
| 25 |
|
2.99E-7 |
-6.52 |
EPI Suite estimation |
|
| 25 |
|
7.94E-6 |
-5.1 |
SPARC |
2 |
| 25 |
|
3.98E-7 |
-6.4 |
Absolv |
2 |
Octanol-water partition ratio
| t/°C |
KOW |
log (KOW) |
method and notes |
reference |
| 25 |
1.41E+9 |
9.15 |
EPI Suite estimation |
|
|
2.04E+8 |
8.31 |
|
1 |
| 25 |
2.51E+9 |
9.4 |
SPARC |
2 |
| 25 |
3.98E+8 |
8.6 |
Absolv |
2 |
| 25 |
1.38E+3 |
3.14 |
|
3 |
Octanol-air partition ratio
| t/°C |
KOA |
log (KOA) |
method and notes |
reference |
| 25 |
4.72E+15 |
15.7 |
EPI Suite estimation |
|
| 25 |
3.16E+14 |
14.5 |
SPARC |
2 |
| 25 |
1.26E+15 |
15.1 |
Absolv |
2 |
Half-life for degradation in air
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
0.7 |
EPI Suite estimation |
|
Half-life for degradation in water
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
180 |
EPI Suite estimation |
|
Half-life for degradation in soil
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
360 |
EPI Suite estimation |
|
Half-life for degradation in sediment
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
1621 |
EPI Suite estimation |
|
References
- 1.
- EFSA report
- 2.
- Zhang et al., Chemosphere 144 (2016) 2401-2408
- 3.
- OECD eChemPortal
