2,3,5,6-tetrabromo-p-xylene
- SMILES
- CC1=C(C(=C(C(=C1Br)Br)Br)Br)C
- CAS number
- 23488-38-2
- Formula
- C8 H6 Br4
- Molecular weight
- Melting point
-
- Entropy of fusion
-
|
not specified
|
ΔfusS/J K-1 mol-1
|
|
Vapor pressure
| t/°C |
PS/Pa |
PL/Pa |
log (PL/Pa) |
method and notes |
reference |
| 25 |
1.17E-5 |
4.58E-3 |
-2.34 |
EPI Suite estimation |
|
|
5.80E-3 |
|
|
|
1 |
| 25 |
|
0.0631 |
-1.2 |
SPARC |
2 |
| 25 |
|
6.31E-4 |
-3.2 |
Absolv |
2 |
Water solubility
| t/°C |
SWS/mol m-3 |
SWL/mol m-3 |
log (SWL/mol m-3) |
method and notes |
reference |
| not specified |
Henry's law constant
| t/°C |
H/Pa m3 mol-1 |
KAW |
log (KAW) |
method and notes |
reference |
| 25 |
|
6.75E-3 |
-2.17 |
EPI Suite estimation |
|
| 25 |
|
1.58E-3 |
-2.8 |
SPARC |
2 |
| 25 |
|
0.0158 |
-1.8 |
Absolv |
2 |
Octanol-water partition ratio
| t/°C |
KOW |
log (KOW) |
method and notes |
reference |
| 25 |
4.47E+6 |
6.65 |
EPI Suite estimation |
|
|
1.58E+6 |
6.2 |
|
1 |
| 25 |
1.00E+6 |
6 |
SPARC |
2 |
| 25 |
2.00E+6 |
6.3 |
Absolv |
2 |
Octanol-air partition ratio
| t/°C |
KOA |
log (KOA) |
method and notes |
reference |
| 25 |
6.62E+8 |
8.82 |
EPI Suite estimation |
|
|
6.31E+8 |
8.8 |
SPARC |
2 |
|
1.26E+8 |
8.1 |
Absolv |
2 |
Half-life for degradation in air
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
22 |
EPI Suite estimation |
|
Half-life for degradation in water
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
180 |
EPI Suite estimation |
|
Half-life for degradation in soil
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
360 |
EPI Suite estimation |
|
Half-life for degradation in sediment
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
1621 |
EPI Suite estimation |
|
References
- 1.
- EFSA Report
- 2.
- Zhang et al., Chemosphere 144 (2016) 2401-2408
