2,4,6-Tribromophenyl 2,3-dibromopropyl ether
- SMILES
- C1=C(C=C(C(=C1Br)OCC(CBr)Br)Br)Br
- CAS number
- 35109-60-5
- Formula
- C9 H7 Br5 O1
- Molecular weight
- Melting point
-
- Entropy of fusion
-
|
not specified
|
ΔfusS/J K-1 mol-1
|
|
Vapor pressure
| t/°C |
PS/Pa |
PL/Pa |
log (PL/Pa) |
method and notes |
reference |
| 25 |
8.29E-5 |
1.57E-3 |
-2.8 |
EPI Suite estimation |
|
| 25 |
|
0.0251 |
-1.6 |
SPARC estimation |
1 |
| 25 |
|
7.94E-6 |
-5.1 |
Absolv estimation |
1 |
Water solubility
| t/°C |
SWS/mol m-3 |
SWL/mol m-3 |
log (SWL/mol m-3) |
method and notes |
reference |
| not specified |
Henry's law constant
| t/°C |
H/Pa m3 mol-1 |
KAW |
log (KAW) |
method and notes |
reference |
| 25 |
|
1.93E-5 |
-4.71 |
EPI Suite estimation |
|
| 25 |
|
7.94E-5 |
-4.1 |
SPARC estimation |
1 |
| 25 |
|
3.16E-5 |
-4.5 |
Absolv estimation |
1 |
Octanol-water partition ratio
| t/°C |
KOW |
log (KOW) |
method and notes |
reference |
| 25 |
2.19E+6 |
6.34 |
EPI Suite estimation |
|
| 25 |
3.16E+6 |
6.5 |
SPARC estimation |
1 |
| 25 |
2.51E+6 |
6.4 |
Absolv estimation |
1 |
Octanol-air partition ratio
| t/°C |
KOA |
log (KOA) |
method and notes |
reference |
| 25 |
1.14E+11 |
11.1 |
EPI Suite estimation |
|
| 25 |
3.98E+10 |
10.6 |
SPARC estimation |
1 |
| 25 |
1.00E+11 |
11 |
Absolv estimation |
1 |
Half-life for degradation in air
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
2.6 |
EPI Suite estimation |
|
Half-life for degradation in water
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
180 |
EPI Suite estimation |
|
Half-life for degradation in soil
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
360 |
EPI Suite estimation |
|
Half-life for degradation in sediment
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
1621 |
EPI Suite estimation |
|
References
- 1.
- Zhang et al., Chemosphere 144 (2016) 2401-2408
