Decabromodiphenylethane (DBDPE)
- SMILES
- C(CC1=C(C(=C(C(=C1Br)Br)Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br
- CAS number
- 84852-53-9
- Formula
- C14 H4 Br10
- Molecular weight
- Melting point
-
- Entropy of fusion
-
|
not specified
|
ΔfusS/J K-1 mol-1
|
|
Vapor pressure
| t/°C |
PS/Pa |
PL/Pa |
log (PL/Pa) |
method and notes |
reference |
| 25 |
2.54E-11 |
9.33E-9 |
-8.03 |
EPI Suite estimation |
|
|
8.00E-12 |
|
|
|
1 |
| 25 |
|
2.00E-10 |
-9.7 |
SPARC |
2 |
| 25 |
|
5.01E-16 |
-15.3 |
Absolv |
2 |
Water solubility
| t/°C |
SWS/mol m-3 |
SWL/mol m-3 |
log (SWL/mol m-3) |
method and notes |
reference |
| not specified |
Henry's law constant
| t/°C |
H/Pa m3 mol-1 |
KAW |
log (KAW) |
method and notes |
reference |
| 25 |
|
2.62E-6 |
-5.58 |
EPI Suite estimation |
|
| 25 |
|
1.00E-6 |
-6 |
SPARC |
2 |
| 25 |
|
2.51E-6 |
-5.6 |
Absolv |
2 |
Octanol-water partition ratio
| t/°C |
KOW |
log (KOW) |
method and notes |
reference |
| 25 |
4.37E+13 |
13.6 |
EPI Suite estimation |
|
|
1.26E+11 |
11.1 |
|
1 |
| 25 |
1.58E+12 |
12.2 |
SPARC |
2 |
| 25 |
3.98E+12 |
12.6 |
Absolv |
2 |
| 25 |
3.55E+3 |
3.55 |
|
3 |
Octanol-air partition ratio
| t/°C |
KOA |
log (KOA) |
method and notes |
reference |
| 25 |
1.66E+19 |
19.2 |
EPI Suite estimation |
|
| 25 |
1.58E+18 |
18.2 |
SPARC |
2 |
| 25 |
1.58E+18 |
18.2 |
Absolv |
2 |
Half-life for degradation in air
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
4.5 |
EPI Suite estimation |
|
Half-life for degradation in water
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
180 |
EPI Suite estimation |
|
Half-life for degradation in soil
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
360 |
EPI Suite estimation |
|
Half-life for degradation in sediment
| t/°C |
half-life/day |
method and notes |
reference |
| 25 |
1621 |
EPI Suite estimation |
|
References
- 1.
- EFSA report
- 2.
- Zhang et al., Chemosphere 144 (2016) 2401-2408
- 3.
- ECHA chemical registration database
